C20H25ClN4O2S — CID 119767662
2-(aminomethyl)-N-methyl-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119767662) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is 2-(aminomethyl)-N-methyl-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(aminomethyl)-N-methyl-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119767662 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-(aminomethyl)-N-methyl-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CN(CCCCCc1cc(-c2ccccc2)no1)C(=O)c1csc(CN)n1.Cl |
| InChI | InChI=1S/C20H24N4O2S.ClH/c1-24(20(25)18-14-27-19(13-21)22-18)11-7-3-6-10-16-12-17(23-26-16)15-8-4-2-5-9-15;/h2,4-5,8-9,12,14H,3,6-7,10-11,13,21H2,1H3;1H |
| InChIKey | ZDQADWPHZKEVRM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|