C12H16N2O — CID 143675921
ethane;5-ethyl-3-pyridin-3-yl-1,2-oxazole (PubChem CID 143675921) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is ethane;5-ethyl-3-pyridin-3-yl-1,2-oxazole.
| Compound Name | ethane;5-ethyl-3-pyridin-3-yl-1,2-oxazole |
|---|---|
| PubChem CID | 143675921 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | ethane;5-ethyl-3-pyridin-3-yl-1,2-oxazole |
| SMILES | CC.CCc1cc(-c2cccnc2)no1 |
| InChI | InChI=1S/C10H10N2O.C2H6/c1-2-9-6-10(12-13-9)8-4-3-5-11-7-8;1-2/h3-7H,2H2,1H3;1-2H3 |
| InChIKey | XJSCYXAAHJYTMG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |