C12H13NO3 — CID 176993673
formic acid;3-methyl-5-(3-methylphenyl)-1,2-oxazole (PubChem CID 176993673) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is formic acid;3-methyl-5-(3-methylphenyl)-1,2-oxazole.
| Compound Name | formic acid;3-methyl-5-(3-methylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 176993673 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | formic acid;3-methyl-5-(3-methylphenyl)-1,2-oxazole |
| SMILES | Cc1cccc(-c2cc(C)no2)c1.O=CO |
| InChI | InChI=1S/C11H11NO.CH2O2/c1-8-4-3-5-10(6-8)11-7-9(2)12-13-11;2-1-3/h3-7H,1-2H3;1H,(H,2,3) |
| InChIKey | JSQOMUVCGLSXEH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|