C10H8NO3S- — CID 68532837
3-(3-methyl-1,2-oxazol-5-yl)benzenesulfinate (PubChem CID 68532837) has the molecular formula C10H8NO3S- and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-(3-methyl-1,2-oxazol-5-yl)benzenesulfinate.
| Compound Name | 3-(3-methyl-1,2-oxazol-5-yl)benzenesulfinate |
|---|---|
| PubChem CID | 68532837 |
| Molecular Formula | C10H8NO3S- |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 3-(3-methyl-1,2-oxazol-5-yl)benzenesulfinate |
| SMILES | Cc1cc(-c2cccc(S(=O)[O-])c2)on1 |
| InChI | InChI=1S/C10H9NO3S/c1-7-5-10(14-11-7)8-3-2-4-9(6-8)15(12)13/h2-6H,1H3,(H,12,13)/p-1 |
| InChIKey | NXKRNNQRYLAXJT-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|