C11H11NO3S — CID 116868966
3-methyl-5-(4-methylsulfonylphenyl)-1,2-oxazole (PubChem CID 116868966) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-methyl-5-(4-methylsulfonylphenyl)-1,2-oxazole.
| Compound Name | 3-methyl-5-(4-methylsulfonylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 116868966 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 3-methyl-5-(4-methylsulfonylphenyl)-1,2-oxazole |
| SMILES | Cc1cc(-c2ccc(S(C)(=O)=O)cc2)on1 |
| InChI | InChI=1S/C11H11NO3S/c1-8-7-11(15-12-8)9-3-5-10(6-4-9)16(2,13)14/h3-7H,1-2H3 |
| InChIKey | OSAIEAUPLTZXAI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |