C22H22N4O4S — CID 91949760
N-[3-(3-methylindazol-1-yl)propyl]-5-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 91949760) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-[3-(3-methylindazol-1-yl)propyl]-5-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(3-methylindazol-1-yl)propyl]-5-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 91949760 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[3-(3-methylindazol-1-yl)propyl]-5-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2cc(-c3ccc(S(C)(=O)=O)cc3)on2)c2ccccc12 |
| InChI | InChI=1S/C22H22N4O4S/c1-15-18-6-3-4-7-20(18)26(24-15)13-5-12-23-22(27)19-14-21(30-25-19)16-8-10-17(11-9-16)31(2,28)29/h3-4,6-11,14H,5,12-13H2,1-2H3,(H,23,27) |
| InChIKey | ARPDQAAEYVSZKV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|