C12H13NO2S — CID 143797490
5-(3-methylphenyl)-3-(methylsulfanyloxymethyl)-1,2-oxazole (PubChem CID 143797490) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 5-(3-methylphenyl)-3-(methylsulfanyloxymethyl)-1,2-oxazole.
| Compound Name | 5-(3-methylphenyl)-3-(methylsulfanyloxymethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 143797490 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 5-(3-methylphenyl)-3-(methylsulfanyloxymethyl)-1,2-oxazole |
| SMILES | CSOCc1cc(-c2cccc(C)c2)on1 |
| InChI | InChI=1S/C12H13NO2S/c1-9-4-3-5-10(6-9)12-7-11(13-15-12)8-14-16-2/h3-7H,8H2,1-2H3 |
| InChIKey | LVSLXFOPMIAEKT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|