C12H15NO — CID 161177844
methane;5-methyl-3-(3-methylphenyl)-1,2-oxazole (PubChem CID 161177844) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is methane;5-methyl-3-(3-methylphenyl)-1,2-oxazole.
| Compound Name | methane;5-methyl-3-(3-methylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 161177844 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | methane;5-methyl-3-(3-methylphenyl)-1,2-oxazole |
| SMILES | C.Cc1cccc(-c2cc(C)on2)c1 |
| InChI | InChI=1S/C11H11NO.CH4/c1-8-4-3-5-10(6-8)11-7-9(2)13-12-11;/h3-7H,1-2H3;1H4 |
| InChIKey | USAYJRVXZIKYIK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |