C12H14N2O — CID 19082396
N-ethyl-3-(3-methylphenyl)-1,2-oxazol-5-amine (PubChem CID 19082396) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is N-ethyl-3-(3-methylphenyl)-1,2-oxazol-5-amine.
| Compound Name | N-ethyl-3-(3-methylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 19082396 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-ethyl-3-(3-methylphenyl)-1,2-oxazol-5-amine |
| SMILES | CCNc1cc(-c2cccc(C)c2)no1 |
| InChI | InChI=1S/C12H14N2O/c1-3-13-12-8-11(14-15-12)10-6-4-5-9(2)7-10/h4-8,13H,3H2,1-2H3 |
| InChIKey | AWUVLAUESBMNKT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |