C12H20N2O — CID 84748167
1-(4-methoxyphenyl)-2-N',2-N'-dimethylpropane-2,2-diamine (PubChem CID 84748167) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-N',2-N'-dimethylpropane-2,2-diamine.
| Compound Name | 1-(4-methoxyphenyl)-2-N',2-N'-dimethylpropane-2,2-diamine |
|---|---|
| PubChem CID | 84748167 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-N',2-N'-dimethylpropane-2,2-diamine |
| SMILES | COc1ccc(CC(C)(N)N(C)C)cc1 |
| InChI | InChI=1S/C12H20N2O/c1-12(13,14(2)3)9-10-5-7-11(15-4)8-6-10/h5-8H,9,13H2,1-4H3 |
| InChIKey | CVSXJGNAGDXADA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|