C14H21NO6 — CID 146181886
3,4-dihydroxybutyl (2S)-3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoate (PubChem CID 146181886) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is 3,4-dihydroxybutyl (2S)-3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoate.
| Compound Name | 3,4-dihydroxybutyl (2S)-3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 146181886 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3,4-dihydroxybutyl (2S)-3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoate |
| SMILES | CN[C@@H](Cc1ccc(O)c(O)c1)C(=O)OCCC(O)CO |
| InChI | InChI=1S/C14H21NO6/c1-15-11(14(20)21-5-4-10(17)8-16)6-9-2-3-12(18)13(19)7-9/h2-3,7,10-11,15-19H,4-6,8H2,1H3/t10?,11-/m0/s1 |
| InChIKey | WAGBYZBWXWHMCD-DTIOYNMSSA-N |
| XLogP | -0.49 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|