C22H26N4O4S — CID 25342748
N-[2-(ethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 25342748) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-[2-(ethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(ethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 25342748 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[2-(ethylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | CCNc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H26N4O4S/c1-2-23-20-8-7-17(31(28,29)26-9-11-30-12-10-26)14-21(20)25-22(27)13-16-15-24-19-6-4-3-5-18(16)19/h3-8,14-15,23-24H,2,9-13H2,1H3,(H,25,27) |
| InChIKey | XKNUJJHLDSCMTD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |