C22H27Cl2N3O4S — CID 4831808
N-[2-(butylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2,6-dichlorophenyl)acetamide (PubChem CID 4831808) has the molecular formula C22H27Cl2N3O4S and a molecular weight of 500.45 g/mol. Its IUPAC name is N-[2-(butylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-[2-(butylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4831808 |
| Molecular Formula | C22H27Cl2N3O4S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | N-[2-(butylamino)-5-morpholin-4-ylsulfonylphenyl]-2-(2,6-dichlorophenyl)acetamide |
| SMILES | CCCCNc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H27Cl2N3O4S/c1-2-3-9-25-20-8-7-16(32(29,30)27-10-12-31-13-11-27)14-21(20)26-22(28)15-17-18(23)5-4-6-19(17)24/h4-8,14,25H,2-3,9-13,15H2,1H3,(H,26,28) |
| InChIKey | MQMORGBVCFQQHS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|