C20H24ClN3O4S — CID 16553115
2-(2-chloro-4-methylanilino)-N-(2-methyl-5-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 16553115) has the molecular formula C20H24ClN3O4S and a molecular weight of 437.95 g/mol. Its IUPAC name is 2-(2-chloro-4-methylanilino)-N-(2-methyl-5-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-chloro-4-methylanilino)-N-(2-methyl-5-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 16553115 |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-(2-chloro-4-methylanilino)-N-(2-methyl-5-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(NCC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2C)c(Cl)c1 |
| InChI | InChI=1S/C20H24ClN3O4S/c1-14-3-6-18(17(21)11-14)22-13-20(25)23-19-12-16(5-4-15(19)2)29(26,27)24-7-9-28-10-8-24/h3-6,11-12,22H,7-10,13H2,1-2H3,(H,23,25) |
| InChIKey | DOQMPIPYPLFQSI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |