C16H23N3O4S3 — CID 4640927
[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 4640927) has the molecular formula C16H23N3O4S3 and a molecular weight of 417.58 g/mol. Its IUPAC name is [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 4640927 |
| Molecular Formula | C16H23N3O4S3 |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)CSC(=S)N(C)C |
| InChI | InChI=1S/C16H23N3O4S3/c1-12-4-5-13(26(21,22)19-6-8-23-9-7-19)10-14(12)17-15(20)11-25-16(24)18(2)3/h4-5,10H,6-9,11H2,1-3H3,(H,17,20) |
| InChIKey | JTGSOVGGZURIER-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|