C19H27N3O4S — CID 42948466
N-[2-(ethylamino)-5-morpholin-4-ylsulfonylphenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 42948466) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[2-(ethylamino)-5-morpholin-4-ylsulfonylphenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[2-(ethylamino)-5-morpholin-4-ylsulfonylphenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 42948466 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[2-(ethylamino)-5-morpholin-4-ylsulfonylphenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CCNc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C19H27N3O4S/c1-2-20-17-9-8-16(27(24,25)22-10-12-26-13-11-22)14-18(17)21-19(23)15-6-4-3-5-7-15/h3-4,8-9,14-15,20H,2,5-7,10-13H2,1H3,(H,21,23) |
| InChIKey | GRUWRAXBFIMTAP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|