C22H35N3O4S — CID 25336261
3-cyclopentyl-N-[2-(2-methylpropylamino)-5-morpholin-4-ylsulfonylphenyl]propanamide (PubChem CID 25336261) has the molecular formula C22H35N3O4S and a molecular weight of 437.61 g/mol. Its IUPAC name is 3-cyclopentyl-N-[2-(2-methylpropylamino)-5-morpholin-4-ylsulfonylphenyl]propanamide.
| Compound Name | 3-cyclopentyl-N-[2-(2-methylpropylamino)-5-morpholin-4-ylsulfonylphenyl]propanamide |
|---|---|
| PubChem CID | 25336261 |
| Molecular Formula | C22H35N3O4S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 3-cyclopentyl-N-[2-(2-methylpropylamino)-5-morpholin-4-ylsulfonylphenyl]propanamide |
| SMILES | CC(C)CNc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C22H35N3O4S/c1-17(2)16-23-20-9-8-19(30(27,28)25-11-13-29-14-12-25)15-21(20)24-22(26)10-7-18-5-3-4-6-18/h8-9,15,17-18,23H,3-7,10-14,16H2,1-2H3,(H,24,26) |
| InChIKey | HQKABXVGKXXDOI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |