C15H12Cl2N2O5 — CID 78765457
N-(2,4-dichlorophenyl)-2-(4-methoxy-2-nitrophenoxy)acetamide (PubChem CID 78765457) has the molecular formula C15H12Cl2N2O5 and a molecular weight of 371.18 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(4-methoxy-2-nitrophenoxy)acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(4-methoxy-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 78765457 |
| Molecular Formula | C15H12Cl2N2O5 |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(4-methoxy-2-nitrophenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)Nc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12Cl2N2O5/c1-23-10-3-5-14(13(7-10)19(21)22)24-8-15(20)18-12-4-2-9(16)6-11(12)17/h2-7H,8H2,1H3,(H,18,20) |
| InChIKey | FLXBYPPHWLBAEL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|