C27H35N5O8S — CID 98394692
1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-[2-methoxy-4-[(Z)-[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)hydrazinylidene]methyl]phenoxy]ethanone (PubChem CID 98394692) has the molecular formula C27H35N5O8S and a molecular weight of 589.67 g/mol. Its IUPAC name is 1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-[2-methoxy-4-[(Z)-[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)hydrazinylidene]methyl]phenoxy]ethanone.
| Compound Name | 1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-[2-methoxy-4-[(Z)-[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)hydrazinylidene]methyl]phenoxy]ethanone |
|---|---|
| PubChem CID | 98394692 |
| Molecular Formula | C27H35N5O8S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-[2-methoxy-4-[(Z)-[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)hydrazinylidene]methyl]phenoxy]ethanone |
| SMILES | COc1cc(/C=N\Nc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])ccc1OCC(=O)N1[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C27H35N5O8S/c1-19-5-4-6-20(2)31(19)27(33)18-40-25-10-7-21(15-26(25)38-3)17-28-29-23-9-8-22(16-24(23)32(34)35)41(36,37)30-11-13-39-14-12-30/h7-10,15-17,19-20,29H,4-6,11-14,18H2,1-3H3/b28-17-/t19-,20+ |
| InChIKey | BGJSRTAPTLPNSW-UMQZOJJQSA-N |
| XLogP | 3.24 |
| TPSA | 152.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|