C18H20N2O6S — CID 4261071
4-[4-(2,5-dimethylphenoxy)-3-nitrophenyl]sulfonylmorpholine (PubChem CID 4261071) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is 4-[4-(2,5-dimethylphenoxy)-3-nitrophenyl]sulfonylmorpholine.
| Compound Name | 4-[4-(2,5-dimethylphenoxy)-3-nitrophenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 4261071 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 4-[4-(2,5-dimethylphenoxy)-3-nitrophenyl]sulfonylmorpholine |
| SMILES | Cc1ccc(C)c(Oc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N2O6S/c1-13-3-4-14(2)18(11-13)26-17-6-5-15(12-16(17)20(21)22)27(23,24)19-7-9-25-10-8-19/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | FDBRNKAUIGFSKW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|