C20H23ClN2O5S2 — CID 4850440
1-[4-[2-(2-chlorophenoxy)ethylsulfanyl]-3-nitrophenyl]sulfonylazepane (PubChem CID 4850440) has the molecular formula C20H23ClN2O5S2 and a molecular weight of 471.00 g/mol. Its IUPAC name is 1-[4-[2-(2-chlorophenoxy)ethylsulfanyl]-3-nitrophenyl]sulfonylazepane.
| Compound Name | 1-[4-[2-(2-chlorophenoxy)ethylsulfanyl]-3-nitrophenyl]sulfonylazepane |
|---|---|
| PubChem CID | 4850440 |
| Molecular Formula | C20H23ClN2O5S2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 1-[4-[2-(2-chlorophenoxy)ethylsulfanyl]-3-nitrophenyl]sulfonylazepane |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCCC2)ccc1SCCOc1ccccc1Cl |
| InChI | InChI=1S/C20H23ClN2O5S2/c21-17-7-3-4-8-19(17)28-13-14-29-20-10-9-16(15-18(20)23(24)25)30(26,27)22-11-5-1-2-6-12-22/h3-4,7-10,15H,1-2,5-6,11-14H2 |
| InChIKey | KXUVRFPQWPZZEO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|