C22H26N4O6S — CID 4787195
1-[4-[4-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)phenyl]piperazin-1-yl]ethanone (PubChem CID 4787195) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is 1-[4-[4-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4787195 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 1-[4-[4-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(Oc3ccc(S(=O)(=O)N4CCCC4)cc3[N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C22H26N4O6S/c1-17(27)23-12-14-24(15-13-23)18-4-6-19(7-5-18)32-22-9-8-20(16-21(22)26(28)29)33(30,31)25-10-2-3-11-25/h4-9,16H,2-3,10-15H2,1H3 |
| InChIKey | IHDZSNZYRIHPSU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|