C20H16Cl2IN3O4S — CID 126196359
(Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid (PubChem CID 126196359) has the molecular formula C20H16Cl2IN3O4S and a molecular weight of 592.24 g/mol. Its IUPAC name is (Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126196359 |
| Molecular Formula | C20H16Cl2IN3O4S |
| Molecular Weight | 592.24 g/mol |
| Exact Mass | 590.93 |
| IUPAC Name | (Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C(\Sc2n[nH]c(C)n2)C(=O)O)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2IN3O4S/c1-10-24-20(26-25-10)31-17(19(27)28)7-11-5-15(23)18(16(6-11)29-2)30-9-12-3-4-13(21)8-14(12)22/h3-8H,9H2,1-2H3,(H,27,28)(H,24,25,26)/b17-7- |
| InChIKey | KVKPCIQBJGBKSH-IDUWFGFVSA-N |
| XLogP | 5.83 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.24 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|