C26H19ClF3IN2O3 — CID 4163874
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-[3-iodo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 4163874) has the molecular formula C26H19ClF3IN2O3 and a molecular weight of 626.80 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-[3-iodo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-[3-iodo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4163874 |
| Molecular Formula | C26H19ClF3IN2O3 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.01 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-[3-iodo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)cc(I)c1OCc1ccccc1C |
| InChI | InChI=1S/C26H19ClF3IN2O3/c1-15-5-3-4-6-17(15)14-36-24-21(31)10-16(11-23(24)35-2)9-18(13-32)25(34)33-22-12-19(26(28,29)30)7-8-20(22)27/h3-12H,14H2,1-2H3,(H,33,34) |
| InChIKey | NSPPVBCRDSCQHD-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|