C25H17BrClF3N2O3 — CID 2372363
(E)-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide (PubChem CID 2372363) has the molecular formula C25H17BrClF3N2O3 and a molecular weight of 565.77 g/mol. Its IUPAC name is (E)-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 2372363 |
| Molecular Formula | C25H17BrClF3N2O3 |
| Molecular Weight | 565.77 g/mol |
| Exact Mass | 564.01 |
| IUPAC Name | (E)-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
| SMILES | COc1cccc(/C=C(\C#N)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H17BrClF3N2O3/c1-34-22-4-2-3-16(23(22)35-14-15-5-8-19(26)9-6-15)11-17(13-31)24(33)32-21-12-18(25(28,29)30)7-10-20(21)27/h2-12H,14H2,1H3,(H,32,33)/b17-11+ |
| InChIKey | FVAGXQORVGKKGY-GZTJUZNOSA-N |
| XLogP | 7.25 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.77 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|