C23H18I2N4O4 — CID 126393186
(Z)-2-cyano-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide (PubChem CID 126393186) has the molecular formula C23H18I2N4O4 and a molecular weight of 668.23 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126393186 |
| Molecular Formula | C23H18I2N4O4 |
| Molecular Weight | 668.23 g/mol |
| Exact Mass | 667.94 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
| SMILES | Cc1ccc(C)n1NC(=O)/C(C#N)=C\c1cc(I)c(OCc2ccc([N+](=O)[O-])cc2)c(I)c1 |
| InChI | InChI=1S/C23H18I2N4O4/c1-14-3-4-15(2)28(14)27-23(30)18(12-26)9-17-10-20(24)22(21(25)11-17)33-13-16-5-7-19(8-6-16)29(31)32/h3-11H,13H2,1-2H3,(H,27,30)/b18-9- |
| InChIKey | VTEQQTHZIFWYCG-NVMNQCDNSA-N |
| XLogP | 5.48 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.23 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|