C25H23NO2 — CID 5221453
4,4-dimethyl-2-[[4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-oxopentanenitrile (PubChem CID 5221453) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 4,4-dimethyl-2-[[4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-oxopentanenitrile.
| Compound Name | 4,4-dimethyl-2-[[4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-oxopentanenitrile |
|---|---|
| PubChem CID | 5221453 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4,4-dimethyl-2-[[4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-oxopentanenitrile |
| SMILES | CC(C)(C)C(=O)C(C#N)=Cc1ccc(OCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H23NO2/c1-25(2,3)24(27)21(16-26)15-18-11-13-22(14-12-18)28-17-20-9-6-8-19-7-4-5-10-23(19)20/h4-15H,17H2,1-3H3 |
| InChIKey | YQQGWCJCEPMZGQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|