C20H17BrFN3O4 — CID 1348483
(E)-3-[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 1348483) has the molecular formula C20H17BrFN3O4 and a molecular weight of 462.28 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1348483 |
| Molecular Formula | C20H17BrFN3O4 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-bromo-5-ethoxyphenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2ccccc2F)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C20H17BrFN3O4/c1-2-28-17-9-12(8-14(21)19(17)29-11-18(24)26)7-13(10-23)20(27)25-16-6-4-3-5-15(16)22/h3-9H,2,11H2,1H3,(H2,24,26)(H,25,27)/b13-7+ |
| InChIKey | PKQUXNGXXZJCQE-NTUHNPAUSA-N |
| XLogP | 3.40 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|