C26H21BrFN3O5 — CID 126382370
(E)-3-[3-bromo-5-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 126382370) has the molecular formula C26H21BrFN3O5 and a molecular weight of 554.37 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-5-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126382370 |
| Molecular Formula | C26H21BrFN3O5 |
| Molecular Weight | 554.37 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | (E)-3-[3-bromo-5-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2ccc(O)cc2)cc(Br)c1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C26H21BrFN3O5/c1-2-35-23-13-16(11-17(14-29)26(34)30-18-7-9-19(32)10-8-18)12-20(27)25(23)36-15-24(33)31-22-6-4-3-5-21(22)28/h3-13,32H,2,15H2,1H3,(H,30,34)(H,31,33)/b17-11+ |
| InChIKey | JWLRHURXEIRYFL-GZTJUZNOSA-N |
| XLogP | 5.26 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|