C19H13N3O3 — CID 22302129
methyl 2-[[(Z)-2-cyano-3-(4-cyanophenyl)prop-2-enoyl]amino]benzoate (PubChem CID 22302129) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is methyl 2-[[(Z)-2-cyano-3-(4-cyanophenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2-[[(Z)-2-cyano-3-(4-cyanophenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 22302129 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | methyl 2-[[(Z)-2-cyano-3-(4-cyanophenyl)prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)/C(C#N)=C\c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H13N3O3/c1-25-19(24)16-4-2-3-5-17(16)22-18(23)15(12-21)10-13-6-8-14(11-20)9-7-13/h2-10H,1H3,(H,22,23)/b15-10- |
| InChIKey | IVNIOEPZNNUFOG-GDNBJRDFSA-N |
| XLogP | 2.89 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|