C23H18BrN3O5 — CID 170916998
[2-bromo-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]-6-methoxyphenyl] 4-methylbenzoate (PubChem CID 170916998) has the molecular formula C23H18BrN3O5 and a molecular weight of 496.32 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]-6-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [2-bromo-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]-6-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 170916998 |
| Molecular Formula | C23H18BrN3O5 |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | [2-bromo-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]-6-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cc(C)on2)cc(Br)c1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H18BrN3O5/c1-13-4-6-16(7-5-13)23(29)31-21-18(24)10-15(11-19(21)30-3)9-17(12-25)22(28)26-20-8-14(2)32-27-20/h4-11H,1-3H3,(H,26,27,28)/b17-9- |
| InChIKey | SKANIPNPDRBGDD-MFOYZWKCSA-N |
| XLogP | 4.83 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|