C20H14ClN3O6 — CID 170917344
[2-chloro-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]-6-methoxyphenyl] furan-2-carboxylate (PubChem CID 170917344) has the molecular formula C20H14ClN3O6 and a molecular weight of 427.80 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]-6-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [2-chloro-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]-6-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 170917344 |
| Molecular Formula | C20H14ClN3O6 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | [2-chloro-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]-6-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cc(C)on2)cc(Cl)c1OC(=O)c1ccco1 |
| InChI | InChI=1S/C20H14ClN3O6/c1-11-6-17(24-30-11)23-19(25)13(10-22)7-12-8-14(21)18(16(9-12)27-2)29-20(26)15-4-3-5-28-15/h3-9H,1-2H3,(H,23,24,25)/b13-7- |
| InChIKey | XQGSMSHMKKGSTG-QPEQYQDCSA-N |
| XLogP | 4.00 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|