C23H20N4O5S2 — CID 170917156
(Z)-3-[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170917156) has the molecular formula C23H20N4O5S2 and a molecular weight of 496.57 g/mol. Its IUPAC name is (Z)-3-[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170917156 |
| Molecular Formula | C23H20N4O5S2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCSc1nsc(NC(=O)/C(C#N)=C\c2ccc(OCc3ccc4c(c3)OCO4)c(OC)c2)n1 |
| InChI | InChI=1S/C23H20N4O5S2/c1-3-33-23-26-22(34-27-23)25-21(28)16(11-24)8-14-4-6-17(19(9-14)29-2)30-12-15-5-7-18-20(10-15)32-13-31-18/h4-10H,3,12-13H2,1-2H3,(H,25,26,27,28)/b16-8- |
| InChIKey | DFUIEYMHAADDJB-PXNMLYILSA-N |
| XLogP | 4.51 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|