C23H21N3O6S — CID 3974430
[4-[2-cyano-3-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 3974430) has the molecular formula C23H21N3O6S and a molecular weight of 467.50 g/mol. Its IUPAC name is [4-[2-cyano-3-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[2-cyano-3-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 3974430 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [4-[2-cyano-3-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | CCOc1ccc2nc(NC(=O)C(C#N)=Cc3cc(OC)c(OC(C)=O)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C23H21N3O6S/c1-5-31-16-6-7-17-20(11-16)33-23(25-17)26-22(28)15(12-24)8-14-9-18(29-3)21(32-13(2)27)19(10-14)30-4/h6-11H,5H2,1-4H3,(H,25,26,28) |
| InChIKey | WDTCPWPKQZFDAW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|