C26H29NO8S — CID 54317413
2-thiophen-2-ylethyl 3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate (PubChem CID 54317413) has the molecular formula C26H29NO8S and a molecular weight of 515.58 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate.
| Compound Name | 2-thiophen-2-ylethyl 3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 54317413 |
| Molecular Formula | C26H29NO8S |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 2-thiophen-2-ylethyl 3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate |
| SMILES | CC(C)COC(=O)Oc1ccc(C=C(C#N)C(=O)OCCc2cccs2)cc1OC(=O)OCC(C)C |
| InChI | InChI=1S/C26H29NO8S/c1-17(2)15-32-25(29)34-22-8-7-19(13-23(22)35-26(30)33-16-18(3)4)12-20(14-27)24(28)31-10-9-21-6-5-11-36-21/h5-8,11-13,17-18H,9-10,15-16H2,1-4H3 |
| InChIKey | SPEUWGVSGXFRQZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 121.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|