C23H22N2O8 — CID 67796872
1-pyridin-2-ylethyl 3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate (PubChem CID 67796872) has the molecular formula C23H22N2O8 and a molecular weight of 454.44 g/mol. Its IUPAC name is 1-pyridin-2-ylethyl 3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate.
| Compound Name | 1-pyridin-2-ylethyl 3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 67796872 |
| Molecular Formula | C23H22N2O8 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 1-pyridin-2-ylethyl 3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)Oc1ccc(C=C(C#N)C(=O)OC(C)c2ccccn2)cc1OC(=O)OCC |
| InChI | InChI=1S/C23H22N2O8/c1-4-29-22(27)32-19-10-9-16(13-20(19)33-23(28)30-5-2)12-17(14-24)21(26)31-15(3)18-8-6-7-11-25-18/h6-13,15H,4-5H2,1-3H3 |
| InChIKey | AANJXLCZTJNTDN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 134.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|