C24H23NO9 — CID 54122616
2-phenoxyethyl 3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate (PubChem CID 54122616) has the molecular formula C24H23NO9 and a molecular weight of 469.45 g/mol. Its IUPAC name is 2-phenoxyethyl 3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate.
| Compound Name | 2-phenoxyethyl 3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 54122616 |
| Molecular Formula | C24H23NO9 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 2-phenoxyethyl 3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)Oc1ccc(C=C(C#N)C(=O)OCCOc2ccccc2)cc1OC(=O)OCC |
| InChI | InChI=1S/C24H23NO9/c1-3-29-23(27)33-20-11-10-17(15-21(20)34-24(28)30-4-2)14-18(16-25)22(26)32-13-12-31-19-8-6-5-7-9-19/h5-11,14-15H,3-4,12-13H2,1-2H3 |
| InChIKey | NOUITMNJBLQIKU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 130.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|