C28H28N2O10 — CID 143994435
2-[2-[3-[(Z)-1-cyano-2-(3-hydroxy-4-methoxyphenyl)ethenoxy]-3-oxopropoxy]ethoxy]ethyl (Z)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 143994435) has the molecular formula C28H28N2O10 and a molecular weight of 552.54 g/mol. Its IUPAC name is 2-[2-[3-[(Z)-1-cyano-2-(3-hydroxy-4-methoxyphenyl)ethenoxy]-3-oxopropoxy]ethoxy]ethyl (Z)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | 2-[2-[3-[(Z)-1-cyano-2-(3-hydroxy-4-methoxyphenyl)ethenoxy]-3-oxopropoxy]ethoxy]ethyl (Z)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 143994435 |
| Molecular Formula | C28H28N2O10 |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 2-[2-[3-[(Z)-1-cyano-2-(3-hydroxy-4-methoxyphenyl)ethenoxy]-3-oxopropoxy]ethoxy]ethyl (Z)-2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C(/C#N)OC(=O)CCOCCOCCOC(=O)/C(C#N)=C\c2ccc(O)c(OC)c2)cc1O |
| InChI | InChI=1S/C28H28N2O10/c1-35-25-6-4-20(15-24(25)32)14-22(18-30)40-27(33)7-8-37-9-10-38-11-12-39-28(34)21(17-29)13-19-3-5-23(31)26(16-19)36-2/h3-6,13-16,31-32H,7-12H2,1-2H3/b21-13-,22-14- |
| InChIKey | ZCILIUMMERFQRE-JZTLMNBPSA-N |
| XLogP | 3.10 |
| TPSA | 177.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|