C30H34N2O10 — CID 143994430
2-[2-[3-[(Z)-1-cyano-2-(3,4-dimethoxyphenyl)ethenoxy]-3-oxopropoxy]ethoxy]ethyl 2-cyano-3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 143994430) has the molecular formula C30H34N2O10 and a molecular weight of 582.61 g/mol. Its IUPAC name is 2-[2-[3-[(Z)-1-cyano-2-(3,4-dimethoxyphenyl)ethenoxy]-3-oxopropoxy]ethoxy]ethyl 2-cyano-3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | 2-[2-[3-[(Z)-1-cyano-2-(3,4-dimethoxyphenyl)ethenoxy]-3-oxopropoxy]ethoxy]ethyl 2-cyano-3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 143994430 |
| Molecular Formula | C30H34N2O10 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | 2-[2-[3-[(Z)-1-cyano-2-(3,4-dimethoxyphenyl)ethenoxy]-3-oxopropoxy]ethoxy]ethyl 2-cyano-3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COc1ccc(/C=C(/C#N)OC(=O)CCOCCOCCOC(=O)C(C#N)Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C30H34N2O10/c1-35-25-7-5-21(17-27(25)37-3)15-23(19-31)30(34)41-14-13-40-12-11-39-10-9-29(33)42-24(20-32)16-22-6-8-26(36-2)28(18-22)38-4/h5-8,16-18,23H,9-15H2,1-4H3/b24-16- |
| InChIKey | GMNZUMSGSFECNM-JLPGSUDCSA-N |
| XLogP | 3.48 |
| TPSA | 155.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|