C16H17NO4 — CID 57380048
[(2E,4Z)-4-cyano-5-(3,4-dimethoxyphenyl)penta-2,4-dienyl] acetate (PubChem CID 57380048) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is [(2E,4Z)-4-cyano-5-(3,4-dimethoxyphenyl)penta-2,4-dienyl] acetate.
| Compound Name | [(2E,4Z)-4-cyano-5-(3,4-dimethoxyphenyl)penta-2,4-dienyl] acetate |
|---|---|
| PubChem CID | 57380048 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | [(2E,4Z)-4-cyano-5-(3,4-dimethoxyphenyl)penta-2,4-dienyl] acetate |
| SMILES | COc1ccc(/C=C(C#N)/C=C/COC(C)=O)cc1OC |
| InChI | InChI=1S/C16H17NO4/c1-12(18)21-8-4-5-14(11-17)9-13-6-7-15(19-2)16(10-13)20-3/h4-7,9-10H,8H2,1-3H3/b5-4+,14-9- |
| InChIKey | FQVVXMPEFXTTFP-MIRPBGEKSA-N |
| XLogP | 2.73 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|