C20H15ClN4O6S3 — CID 171332798
[2-chloro-4-[2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-6-ethoxyphenyl] thiophene-2-carboxylate (PubChem CID 171332798) has the molecular formula C20H15ClN4O6S3 and a molecular weight of 539.02 g/mol. Its IUPAC name is [2-chloro-4-[2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-6-ethoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [2-chloro-4-[2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-6-ethoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 171332798 |
| Molecular Formula | C20H15ClN4O6S3 |
| Molecular Weight | 539.02 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | [2-chloro-4-[2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-6-ethoxyphenyl] thiophene-2-carboxylate |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nnc(S(C)(=O)=O)s2)cc(Cl)c1OC(=O)c1cccs1 |
| InChI | InChI=1S/C20H15ClN4O6S3/c1-3-30-14-9-11(8-13(21)16(14)31-18(27)15-5-4-6-32-15)7-12(10-22)17(26)23-19-24-25-20(33-19)34(2,28)29/h4-9H,3H2,1-2H3,(H,23,24,26) |
| InChIKey | JVXYLCPLMJWOIP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.02 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|