C20H14BrCl2N3O2S — CID 146215771
(E)-N-[4-(4-bromo-6-methylcyclohexa-1,3-dien-1-yl)-1,3-thiazol-2-yl]-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-enamide (PubChem CID 146215771) has the molecular formula C20H14BrCl2N3O2S and a molecular weight of 511.23 g/mol. Its IUPAC name is (E)-N-[4-(4-bromo-6-methylcyclohexa-1,3-dien-1-yl)-1,3-thiazol-2-yl]-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-bromo-6-methylcyclohexa-1,3-dien-1-yl)-1,3-thiazol-2-yl]-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 146215771 |
| Molecular Formula | C20H14BrCl2N3O2S |
| Molecular Weight | 511.23 g/mol |
| Exact Mass | 508.94 |
| IUPAC Name | (E)-N-[4-(4-bromo-6-methylcyclohexa-1,3-dien-1-yl)-1,3-thiazol-2-yl]-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-enamide |
| SMILES | CC1CC(Br)=CC=C1c1csc(NC(=O)/C(C#N)=C/c2cc(Cl)c(O)c(Cl)c2)n1 |
| InChI | InChI=1S/C20H14BrCl2N3O2S/c1-10-4-13(21)2-3-14(10)17-9-29-20(25-17)26-19(28)12(8-24)5-11-6-15(22)18(27)16(23)7-11/h2-3,5-7,9-10,27H,4H2,1H3,(H,25,26,28)/b12-5+ |
| InChIKey | HYWCWKVZSGMBKW-LFYBBSHMSA-N |
| XLogP | 6.40 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.23 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|