C25H22N2O6S — CID 17280828
propan-2-yl 2-[[(E)-2-cyano-3-[5-(4-ethoxycarbonylphenyl)furan-2-yl]prop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 17280828) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is propan-2-yl 2-[[(E)-2-cyano-3-[5-(4-ethoxycarbonylphenyl)furan-2-yl]prop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[(E)-2-cyano-3-[5-(4-ethoxycarbonylphenyl)furan-2-yl]prop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17280828 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | propan-2-yl 2-[[(E)-2-cyano-3-[5-(4-ethoxycarbonylphenyl)furan-2-yl]prop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C(\C#N)C(=O)Nc3sccc3C(=O)OC(C)C)o2)cc1 |
| InChI | InChI=1S/C25H22N2O6S/c1-4-31-24(29)17-7-5-16(6-8-17)21-10-9-19(33-21)13-18(14-26)22(28)27-23-20(11-12-34-23)25(30)32-15(2)3/h5-13,15H,4H2,1-3H3,(H,27,28)/b18-13+ |
| InChIKey | MPLNXTPNJFUOJH-QGOAFFKASA-N |
| XLogP | 5.30 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|