C25H19BrCl2N2O2 — CID 126259211
(Z)-3-[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126259211) has the molecular formula C25H19BrCl2N2O2 and a molecular weight of 530.25 g/mol. Its IUPAC name is (Z)-3-[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126259211 |
| Molecular Formula | C25H19BrCl2N2O2 |
| Molecular Weight | 530.25 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | (Z)-3-[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C\c1cc(Br)ccc1OCc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C25H19BrCl2N2O2/c1-16(18-5-3-2-4-6-18)30-25(31)20(14-29)12-19-13-21(26)8-10-24(19)32-15-17-7-9-22(27)23(28)11-17/h2-13,16H,15H2,1H3,(H,30,31)/b20-12-/t16-/m1/s1 |
| InChIKey | YKLHQKIHCDXWBT-SDLDRHLBSA-N |
| XLogP | 7.12 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.25 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|