C26H21ClN2O4 — CID 126237941
3-[[2-chloro-4-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]phenoxy]methyl]benzoic acid (PubChem CID 126237941) has the molecular formula C26H21ClN2O4 and a molecular weight of 460.92 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126237941 |
| Molecular Formula | C26H21ClN2O4 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 3-[[2-chloro-4-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]phenoxy]methyl]benzoic acid |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C\c1ccc(OCc2cccc(C(=O)O)c2)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C26H21ClN2O4/c1-17(20-7-3-2-4-8-20)29-25(30)22(15-28)12-18-10-11-24(23(27)14-18)33-16-19-6-5-9-21(13-19)26(31)32/h2-14,17H,16H2,1H3,(H,29,30)(H,31,32)/b22-12-/t17-/m1/s1 |
| InChIKey | MABATETWPSFPCM-MTEVNVADSA-N |
| XLogP | 5.40 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|