C25H20FIN2O2 — CID 126247567
(Z)-2-cyano-3-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126247567) has the molecular formula C25H20FIN2O2 and a molecular weight of 526.35 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126247567 |
| Molecular Formula | C25H20FIN2O2 |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | (Z)-2-cyano-3-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C\c1ccc(OCc2cccc(F)c2)c(I)c1)c1ccccc1 |
| InChI | InChI=1S/C25H20FIN2O2/c1-17(20-7-3-2-4-8-20)29-25(30)21(15-28)12-18-10-11-24(23(27)14-18)31-16-19-6-5-9-22(26)13-19/h2-14,17H,16H2,1H3,(H,29,30)/b21-12-/t17-/m1/s1 |
| InChIKey | SFLVPNYZJWIDLI-CTPANLQCSA-N |
| XLogP | 5.79 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|