C20H18BrIN2O2 — CID 3526206
3-[4-[(4-bromophenyl)methoxy]-3-iodophenyl]-2-cyano-N-propan-2-ylprop-2-enamide (PubChem CID 3526206) has the molecular formula C20H18BrIN2O2 and a molecular weight of 525.18 g/mol. Its IUPAC name is 3-[4-[(4-bromophenyl)methoxy]-3-iodophenyl]-2-cyano-N-propan-2-ylprop-2-enamide.
| Compound Name | 3-[4-[(4-bromophenyl)methoxy]-3-iodophenyl]-2-cyano-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 3526206 |
| Molecular Formula | C20H18BrIN2O2 |
| Molecular Weight | 525.18 g/mol |
| Exact Mass | 523.96 |
| IUPAC Name | 3-[4-[(4-bromophenyl)methoxy]-3-iodophenyl]-2-cyano-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)NC(=O)C(C#N)=Cc1ccc(OCc2ccc(Br)cc2)c(I)c1 |
| InChI | InChI=1S/C20H18BrIN2O2/c1-13(2)24-20(25)16(11-23)9-15-5-8-19(18(22)10-15)26-12-14-3-6-17(21)7-4-14/h3-10,13H,12H2,1-2H3,(H,24,25) |
| InChIKey | UUKLPOIKWDLYDA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.18 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|