C29H23FN2O2 — CID 126248551
(Z)-2-cyano-3-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126248551) has the molecular formula C29H23FN2O2 and a molecular weight of 450.51 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126248551 |
| Molecular Formula | C29H23FN2O2 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (Z)-2-cyano-3-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@H](NC(=O)/C(C#N)=C\c1c(OCc2ccc(F)cc2)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C29H23FN2O2/c1-20(22-7-3-2-4-8-22)32-29(33)24(18-31)17-27-26-10-6-5-9-23(26)13-16-28(27)34-19-21-11-14-25(30)15-12-21/h2-17,20H,19H2,1H3,(H,32,33)/b24-17-/t20-/m0/s1 |
| InChIKey | RJCIOEXPSUZSCN-HLILLCKBSA-N |
| XLogP | 6.34 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|