C22H14I2N4O8 — CID 126402459
methyl 5-[[(4Z)-4-[[3,5-diiodo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126402459) has the molecular formula C22H14I2N4O8 and a molecular weight of 716.18 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3,5-diiodo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3,5-diiodo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126402459 |
| Molecular Formula | C22H14I2N4O8 |
| Molecular Weight | 716.18 g/mol |
| Exact Mass | 715.89 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3,5-diiodo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(I)c(Oc4ccc([N+](=O)[O-])cn4)c(I)c3)C2=O)o1 |
| InChI | InChI=1S/C22H14I2N4O8/c1-34-21(30)17-4-3-13(35-17)10-27-20(29)16(26-22(27)31)8-11-6-14(23)19(15(24)7-11)36-18-5-2-12(9-25-18)28(32)33/h2-9H,10H2,1H3,(H,26,31)/b16-8- |
| InChIKey | AABLJDIXLKSVIA-PXNMLYILSA-N |
| XLogP | 4.46 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.18 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|