C22H15BrN4O8 — CID 126404276
methyl 5-[[(4Z)-4-[[3-bromo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404276) has the molecular formula C22H15BrN4O8 and a molecular weight of 543.29 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3-bromo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3-bromo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404276 |
| Molecular Formula | C22H15BrN4O8 |
| Molecular Weight | 543.29 g/mol |
| Exact Mass | 542.01 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3-bromo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3ccc(Oc4ccc([N+](=O)[O-])cn4)c(Br)c3)C2=O)o1 |
| InChI | InChI=1S/C22H15BrN4O8/c1-33-21(29)18-6-4-14(34-18)11-26-20(28)16(25-22(26)30)9-12-2-5-17(15(23)8-12)35-19-7-3-13(10-24-19)27(31)32/h2-10H,11H2,1H3,(H,25,30)/b16-9- |
| InChIKey | LELJXLZTOMEANZ-SXGWCWSVSA-N |
| XLogP | 4.02 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|